C29H19Cl3O4 — CID 157237113
2,7-dichloro-9-[4-[4-(2-chlorophenyl)butanoyl]phenyl]-6-hydroxyxanthen-3-one (PubChem CID 157237113) has the molecular formula C29H19Cl3O4 and a molecular weight of 537.83 g/mol. Its IUPAC name is 2,7-dichloro-9-[4-[4-(2-chlorophenyl)butanoyl]phenyl]-6-hydroxyxanthen-3-one.
| Compound Name | 2,7-dichloro-9-[4-[4-(2-chlorophenyl)butanoyl]phenyl]-6-hydroxyxanthen-3-one |
|---|---|
| PubChem CID | 157237113 |
| Molecular Formula | C29H19Cl3O4 |
| Molecular Weight | 537.83 g/mol |
| Exact Mass | 536.03 |
| IUPAC Name | 2,7-dichloro-9-[4-[4-(2-chlorophenyl)butanoyl]phenyl]-6-hydroxyxanthen-3-one |
| SMILES | O=C(CCCc1ccccc1Cl)c1ccc(-c2c3cc(Cl)c(=O)cc-3oc3cc(O)c(Cl)cc23)cc1 |
| InChI | InChI=1S/C29H19Cl3O4/c30-21-6-2-1-4-16(21)5-3-7-24(33)17-8-10-18(11-9-17)29-19-12-22(31)25(34)14-27(19)36-28-15-26(35)23(32)13-20(28)29/h1-2,4,6,8-15,34H,3,5,7H2 |
| InChIKey | AUTNJWARIXJWRJ-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.83 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|