C30H23Cl2NO4 — CID 122494170
4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-[2-(4-ethylphenyl)ethyl]benzamide (PubChem CID 122494170) has the molecular formula C30H23Cl2NO4 and a molecular weight of 532.42 g/mol. Its IUPAC name is 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-[2-(4-ethylphenyl)ethyl]benzamide.
| Compound Name | 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-[2-(4-ethylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 122494170 |
| Molecular Formula | C30H23Cl2NO4 |
| Molecular Weight | 532.42 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-[2-(4-ethylphenyl)ethyl]benzamide |
| SMILES | CCc1ccc(CCNC(=O)c2ccc(-c3c4cc(Cl)c(=O)cc-4oc4cc(O)c(Cl)cc34)cc2)cc1 |
| InChI | InChI=1S/C30H23Cl2NO4/c1-2-17-3-5-18(6-4-17)11-12-33-30(36)20-9-7-19(8-10-20)29-21-13-23(31)25(34)15-27(21)37-28-16-26(35)24(32)14-22(28)29/h3-10,13-16,34H,2,11-12H2,1H3,(H,33,36) |
| InChIKey | MCNTYWLXASOAIY-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.42 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|