C24H21Cl2NO4 — CID 134197684
9-[4-[(butan-2-ylamino)-hydroxymethyl]phenyl]-2,7-dichloro-6-hydroxyxanthen-3-one (PubChem CID 134197684) has the molecular formula C24H21Cl2NO4 and a molecular weight of 458.34 g/mol. Its IUPAC name is 9-[4-[(butan-2-ylamino)-hydroxymethyl]phenyl]-2,7-dichloro-6-hydroxyxanthen-3-one.
| Compound Name | 9-[4-[(butan-2-ylamino)-hydroxymethyl]phenyl]-2,7-dichloro-6-hydroxyxanthen-3-one |
|---|---|
| PubChem CID | 134197684 |
| Molecular Formula | C24H21Cl2NO4 |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 9-[4-[(butan-2-ylamino)-hydroxymethyl]phenyl]-2,7-dichloro-6-hydroxyxanthen-3-one |
| SMILES | CCC(C)NC(O)c1ccc(-c2c3cc(Cl)c(=O)cc-3oc3cc(O)c(Cl)cc23)cc1 |
| InChI | InChI=1S/C24H21Cl2NO4/c1-3-12(2)27-24(30)14-6-4-13(5-7-14)23-15-8-17(25)19(28)10-21(15)31-22-11-20(29)18(26)9-16(22)23/h4-12,24,27-28,30H,3H2,1-2H3 |
| InChIKey | XZICZICIISHCQZ-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|