C26H22Cl2O4 — CID 158396640
2,7-dichloro-9-[4-(3,4-dimethylpentanoyl)phenyl]-6-hydroxyxanthen-3-one (PubChem CID 158396640) has the molecular formula C26H22Cl2O4 and a molecular weight of 469.36 g/mol. Its IUPAC name is 2,7-dichloro-9-[4-(3,4-dimethylpentanoyl)phenyl]-6-hydroxyxanthen-3-one.
| Compound Name | 2,7-dichloro-9-[4-(3,4-dimethylpentanoyl)phenyl]-6-hydroxyxanthen-3-one |
|---|---|
| PubChem CID | 158396640 |
| Molecular Formula | C26H22Cl2O4 |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 2,7-dichloro-9-[4-(3,4-dimethylpentanoyl)phenyl]-6-hydroxyxanthen-3-one |
| SMILES | CC(C)C(C)CC(=O)c1ccc(-c2c3cc(Cl)c(=O)cc-3oc3cc(O)c(Cl)cc23)cc1 |
| InChI | InChI=1S/C26H22Cl2O4/c1-13(2)14(3)8-21(29)15-4-6-16(7-5-15)26-17-9-19(27)22(30)11-24(17)32-25-12-23(31)20(28)10-18(25)26/h4-7,9-14,30H,8H2,1-3H3 |
| InChIKey | GXPUPFCTEBJGGE-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|