C27H23Cl2NO4 — CID 122494191
N-(cyclohexylmethyl)-4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzamide (PubChem CID 122494191) has the molecular formula C27H23Cl2NO4 and a molecular weight of 496.39 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzamide.
| Compound Name | N-(cyclohexylmethyl)-4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzamide |
|---|---|
| PubChem CID | 122494191 |
| Molecular Formula | C27H23Cl2NO4 |
| Molecular Weight | 496.39 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | N-(cyclohexylmethyl)-4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzamide |
| SMILES | O=C(NCC1CCCCC1)c1ccc(-c2c3cc(Cl)c(=O)cc-3oc3cc(O)c(Cl)cc23)cc1 |
| InChI | InChI=1S/C27H23Cl2NO4/c28-20-10-18-24(12-22(20)31)34-25-13-23(32)21(29)11-19(25)26(18)16-6-8-17(9-7-16)27(33)30-14-15-4-2-1-3-5-15/h6-13,15,31H,1-5,14H2,(H,30,33) |
| InChIKey | LRRLODBGFVBOHD-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.39 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|