About 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-(2-ethylpentyl)benzamide
4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-(2-ethylpentyl)benzamide (PubChem CID 145138192) has the molecular formula C27H25Cl2NO4
and a molecular weight of 498.41 g/mol. Its IUPAC name is 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-(2-ethylpentyl)benzamide.
Molecular Properties
| Compound Name | 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-(2-ethylpentyl)benzamide |
| PubChem CID | 145138192 |
| Molecular Formula | C27H25Cl2NO4 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-(2-ethylpentyl)benzamide |
| SMILES | CCCC(CC)CNC(=O)c1ccc(-c2c3cc(Cl)c(=O)cc-3oc3cc(O)c(Cl)cc23)cc1 |
| InChI | InChI=1S/C27H25Cl2NO4/c1-3-5-15(4-2)14-30-27(33)17-8-6-16(7-9-17)26-18-10-20(28)22(31)12-24(18)34-25-13-23(32)21(29)11-19(25)26/h6-13,15,31H,3-5,14H2,1-2H3,(H,30,33) |
| InChIKey | JPWYURLVDYKKDK-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-(2-ethylpentyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-(2-ethylpentyl)benzamide?
The IUPAC name of 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-(2-ethylpentyl)benzamide (CID 145138192) is 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-(2-ethylpentyl)benzamide.
What is the SMILES notation for 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-(2-ethylpentyl)benzamide?
The canonical SMILES for 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-(2-ethylpentyl)benzamide is CCCC(CC)CNC(=O)c1ccc(-c2c3cc(Cl)c(=O)cc-3oc3cc(O)c(Cl)cc23)cc1.
What is the InChIKey of 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-(2-ethylpentyl)benzamide?
The InChIKey is JPWYURLVDYKKDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25Cl2NO4/c1-3-5-15(4-2)14-30-27(33)17-8-6-16(7-9-17)26-18-10-20(28)22(31)12-24(18)34-25-13-23(32)21(29)11-19(25)26/h6-13,15,31H,3-5,14H2,1-2H3,(H,30,33).
What are the key properties of 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-(2-ethylpentyl)benzamide?
4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-(2-ethylpentyl)benzamide has a molecular weight of 498.41 g/mol, XLogP of 7.13, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)-N-(2-ethylpentyl)benzamide is sourced from PubChem (CID 145138192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).