C25H19Cl2NO4 — CID 122494123
N-cyclopentyl-4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzamide (PubChem CID 122494123) has the molecular formula C25H19Cl2NO4 and a molecular weight of 468.34 g/mol. Its IUPAC name is N-cyclopentyl-4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzamide.
| Compound Name | N-cyclopentyl-4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzamide |
|---|---|
| PubChem CID | 122494123 |
| Molecular Formula | C25H19Cl2NO4 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | N-cyclopentyl-4-(2,7-dichloro-3-hydroxy-6-oxoxanthen-9-yl)benzamide |
| SMILES | O=C(NC1CCCC1)c1ccc(-c2c3cc(Cl)c(=O)cc-3oc3cc(O)c(Cl)cc23)cc1 |
| InChI | InChI=1S/C25H19Cl2NO4/c26-18-9-16-22(11-20(18)29)32-23-12-21(30)19(27)10-17(23)24(16)13-5-7-14(8-6-13)25(31)28-15-3-1-2-4-15/h5-12,15,29H,1-4H2,(H,28,31) |
| InChIKey | UQFIVIWAFMSADQ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|