C21H16Cl2O3 — CID 158182917
2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one;ethane (PubChem CID 158182917) has the molecular formula C21H16Cl2O3 and a molecular weight of 387.26 g/mol. Its IUPAC name is 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one;ethane.
| Compound Name | 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one;ethane |
|---|---|
| PubChem CID | 158182917 |
| Molecular Formula | C21H16Cl2O3 |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 2,7-dichloro-6-hydroxy-9-phenylxanthen-3-one;ethane |
| SMILES | CC.O=c1cc2oc3cc(O)c(Cl)cc3c(-c3ccccc3)c-2cc1Cl |
| InChI | InChI=1S/C19H10Cl2O3.C2H6/c20-13-6-11-17(8-15(13)22)24-18-9-16(23)14(21)7-12(18)19(11)10-4-2-1-3-5-10;1-2/h1-9,22H;1-2H3 |
| InChIKey | FYUUSSVWJFKSQM-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|