C28H15Cl3O6 — CID 58460657
4-acetyl-3,6-dichloro-2-(2-chloro-3-hydroxy-6-oxo-7-phenylxanthen-9-yl)benzoic acid (PubChem CID 58460657) has the molecular formula C28H15Cl3O6 and a molecular weight of 553.78 g/mol. Its IUPAC name is 4-acetyl-3,6-dichloro-2-(2-chloro-3-hydroxy-6-oxo-7-phenylxanthen-9-yl)benzoic acid.
| Compound Name | 4-acetyl-3,6-dichloro-2-(2-chloro-3-hydroxy-6-oxo-7-phenylxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 58460657 |
| Molecular Formula | C28H15Cl3O6 |
| Molecular Weight | 553.78 g/mol |
| Exact Mass | 551.99 |
| IUPAC Name | 4-acetyl-3,6-dichloro-2-(2-chloro-3-hydroxy-6-oxo-7-phenylxanthen-9-yl)benzoic acid |
| SMILES | CC(=O)c1cc(Cl)c(C(=O)O)c(-c2c3cc(-c4ccccc4)c(=O)cc-3oc3cc(O)c(Cl)cc23)c1Cl |
| InChI | InChI=1S/C28H15Cl3O6/c1-12(32)14-8-19(30)25(28(35)36)26(27(14)31)24-16-7-15(13-5-3-2-4-6-13)20(33)10-22(16)37-23-11-21(34)18(29)9-17(23)24/h2-11,34H,1H3,(H,35,36) |
| InChIKey | WRTSHLQKIYPWJC-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.78 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|