C30H22Cl2O4 — CID 161451367
2,7-dichloro-6-hydroxy-9-[4-(3-phenylpentanoyl)phenyl]xanthen-3-one (PubChem CID 161451367) has the molecular formula C30H22Cl2O4 and a molecular weight of 517.41 g/mol. Its IUPAC name is 2,7-dichloro-6-hydroxy-9-[4-(3-phenylpentanoyl)phenyl]xanthen-3-one.
| Compound Name | 2,7-dichloro-6-hydroxy-9-[4-(3-phenylpentanoyl)phenyl]xanthen-3-one |
|---|---|
| PubChem CID | 161451367 |
| Molecular Formula | C30H22Cl2O4 |
| Molecular Weight | 517.41 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | 2,7-dichloro-6-hydroxy-9-[4-(3-phenylpentanoyl)phenyl]xanthen-3-one |
| SMILES | CCC(CC(=O)c1ccc(-c2c3cc(Cl)c(=O)cc-3oc3cc(O)c(Cl)cc23)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H22Cl2O4/c1-2-17(18-6-4-3-5-7-18)12-25(33)19-8-10-20(11-9-19)30-21-13-23(31)26(34)15-28(21)36-29-16-27(35)24(32)14-22(29)30/h3-11,13-17,34H,2,12H2,1H3 |
| InChIKey | XMPDIPZRADNCOR-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.41 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|