C36H21ClO9 — CID 11635916
4-[2-chloro-6-hydroxy-7-(8-methyl-15,16-dioxatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaen-1-yl)-3-oxoxanthen-9-yl]benzene-1,3-dicarboxylic acid (PubChem CID 11635916) has the molecular formula C36H21ClO9 and a molecular weight of 633.01 g/mol. Its IUPAC name is 4-[2-chloro-6-hydroxy-7-(8-methyl-15,16-dioxatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaen-1-yl)-3-oxoxanthen-9-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[2-chloro-6-hydroxy-7-(8-methyl-15,16-dioxatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaen-1-yl)-3-oxoxanthen-9-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 11635916 |
| Molecular Formula | C36H21ClO9 |
| Molecular Weight | 633.01 g/mol |
| Exact Mass | 632.09 |
| IUPAC Name | 4-[2-chloro-6-hydroxy-7-(8-methyl-15,16-dioxatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaen-1-yl)-3-oxoxanthen-9-yl]benzene-1,3-dicarboxylic acid |
| SMILES | CC12OOC(c3cc4c(-c5ccc(C(=O)O)cc5C(=O)O)c5cc(Cl)c(=O)cc-5oc4cc3O)(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C36H21ClO9/c1-35-22-6-2-4-8-24(22)36(46-45-35,25-9-5-3-7-23(25)35)26-13-20-30(15-28(26)38)44-31-16-29(39)27(37)14-21(31)32(20)18-11-10-17(33(40)41)12-19(18)34(42)43/h2-16,38H,1H3,(H,40,41)(H,42,43) |
| InChIKey | MITDVNFBGKCLIC-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.01 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|