C31H34O7 — CID 166140379
4-(2,7-dibutyl-3-hydroxy-6-oxoxanthen-9-yl)benzene-1,3-dicarboxylic acid;ethane (PubChem CID 166140379) has the molecular formula C31H34O7 and a molecular weight of 518.61 g/mol. Its IUPAC name is 4-(2,7-dibutyl-3-hydroxy-6-oxoxanthen-9-yl)benzene-1,3-dicarboxylic acid;ethane.
| Compound Name | 4-(2,7-dibutyl-3-hydroxy-6-oxoxanthen-9-yl)benzene-1,3-dicarboxylic acid;ethane |
|---|---|
| PubChem CID | 166140379 |
| Molecular Formula | C31H34O7 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 4-(2,7-dibutyl-3-hydroxy-6-oxoxanthen-9-yl)benzene-1,3-dicarboxylic acid;ethane |
| SMILES | CC.CCCCc1cc2c(-c3ccc(C(=O)O)cc3C(=O)O)c3cc(CCCC)c(=O)cc-3oc2cc1O |
| InChI | InChI=1S/C29H28O7.C2H6/c1-3-5-7-16-11-21-25(14-23(16)30)36-26-15-24(31)17(8-6-4-2)12-22(26)27(21)19-10-9-18(28(32)33)13-20(19)29(34)35;1-2/h9-15,30H,3-8H2,1-2H3,(H,32,33)(H,34,35);1-2H3 |
| InChIKey | ZWQGYJMROKPQNW-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|