C27H22N4O8 — CID 118509228
4-[2-[3-(3-azidopropylamino)-3-oxopropyl]-3-hydroxy-6-oxoxanthen-9-yl]benzene-1,3-dicarboxylic acid (PubChem CID 118509228) has the molecular formula C27H22N4O8 and a molecular weight of 530.49 g/mol. Its IUPAC name is 4-[2-[3-(3-azidopropylamino)-3-oxopropyl]-3-hydroxy-6-oxoxanthen-9-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[2-[3-(3-azidopropylamino)-3-oxopropyl]-3-hydroxy-6-oxoxanthen-9-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 118509228 |
| Molecular Formula | C27H22N4O8 |
| Molecular Weight | 530.49 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 4-[2-[3-(3-azidopropylamino)-3-oxopropyl]-3-hydroxy-6-oxoxanthen-9-yl]benzene-1,3-dicarboxylic acid |
| SMILES | [N-]=[N+]=NCCCNC(=O)CCc1cc2c(-c3ccc(C(=O)O)cc3C(=O)O)c3ccc(=O)cc-3oc2cc1O |
| InChI | InChI=1S/C27H22N4O8/c28-31-30-9-1-8-29-24(34)7-3-14-10-20-23(13-21(14)33)39-22-12-16(32)4-6-18(22)25(20)17-5-2-15(26(35)36)11-19(17)27(37)38/h2,4-6,10-13,33H,1,3,7-9H2,(H,29,34)(H,35,36)(H,37,38) |
| InChIKey | BOCGVYONNMCDIV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 202.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|