C27H24N4O7 — CID 130290441
4-[2-[3-[2-(2-azidoethoxy)ethylamino]-3-oxopropyl]-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid (PubChem CID 130290441) has the molecular formula C27H24N4O7 and a molecular weight of 516.51 g/mol. Its IUPAC name is 4-[2-[3-[2-(2-azidoethoxy)ethylamino]-3-oxopropyl]-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid.
| Compound Name | 4-[2-[3-[2-(2-azidoethoxy)ethylamino]-3-oxopropyl]-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 130290441 |
| Molecular Formula | C27H24N4O7 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 4-[2-[3-[2-(2-azidoethoxy)ethylamino]-3-oxopropyl]-3-hydroxy-6-oxoxanthen-9-yl]benzoic acid |
| SMILES | [N-]=[N+]=NCCOCCNC(=O)CCc1cc2c(-c3ccc(C(=O)O)cc3)c3ccc(=O)cc-3oc2cc1O |
| InChI | InChI=1S/C27H24N4O7/c28-31-30-10-12-37-11-9-29-25(34)8-5-18-13-21-24(15-22(18)33)38-23-14-19(32)6-7-20(23)26(21)16-1-3-17(4-2-16)27(35)36/h1-4,6-7,13-15,33H,5,8-12H2,(H,29,34)(H,35,36) |
| InChIKey | ACKOAJCMRUTONH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 174.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|