C27H34N8O6 — CID 175531818
2-N,7-N-bis[2-[2-(2-azidoethoxy)ethoxy]ethyl]-9H-fluorene-2,7-dicarboxamide (PubChem CID 175531818) has the molecular formula C27H34N8O6 and a molecular weight of 566.62 g/mol. Its IUPAC name is 2-N,7-N-bis[2-[2-(2-azidoethoxy)ethoxy]ethyl]-9H-fluorene-2,7-dicarboxamide.
| Compound Name | 2-N,7-N-bis[2-[2-(2-azidoethoxy)ethoxy]ethyl]-9H-fluorene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 175531818 |
| Molecular Formula | C27H34N8O6 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | 2-N,7-N-bis[2-[2-(2-azidoethoxy)ethoxy]ethyl]-9H-fluorene-2,7-dicarboxamide |
| SMILES | [N-]=[N+]=NCCOCCOCCNC(=O)c1ccc2c(c1)Cc1cc(C(=O)NCCOCCOCCN=[N+]=[N-])ccc1-2 |
| InChI | InChI=1S/C27H34N8O6/c28-34-32-7-11-40-15-13-38-9-5-30-26(36)20-1-3-24-22(17-20)19-23-18-21(2-4-25(23)24)27(37)31-6-10-39-14-16-41-12-8-33-35-29/h1-4,17-18H,5-16,19H2,(H,30,36)(H,31,37) |
| InChIKey | HTOPLOVQXPCGHZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 192.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|