C15H19F4N5O4 — CID 165111679
4-amino-N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-2,3,5,6-tetrafluorobenzamide (PubChem CID 165111679) has the molecular formula C15H19F4N5O4 and a molecular weight of 409.34 g/mol. Its IUPAC name is 4-amino-N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-2,3,5,6-tetrafluorobenzamide.
| Compound Name | 4-amino-N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-2,3,5,6-tetrafluorobenzamide |
|---|---|
| PubChem CID | 165111679 |
| Molecular Formula | C15H19F4N5O4 |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 4-amino-N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-2,3,5,6-tetrafluorobenzamide |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCNC(=O)c1c(F)c(F)c(N)c(F)c1F |
| InChI | InChI=1S/C15H19F4N5O4/c16-10-9(11(17)13(19)14(20)12(10)18)15(25)22-1-3-26-5-7-28-8-6-27-4-2-23-24-21/h1-8,20H2,(H,22,25) |
| InChIKey | UAXZMCPHAPDILY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|