C37H47N9O13 — CID 172844336
[2,7-bis[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylcarbamoyl]-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 172844336) has the molecular formula C37H47N9O13 and a molecular weight of 825.83 g/mol. Its IUPAC name is [2,7-bis[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylcarbamoyl]-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | [2,7-bis[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylcarbamoyl]-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 172844336 |
| Molecular Formula | C37H47N9O13 |
| Molecular Weight | 825.83 g/mol |
| Exact Mass | 825.33 |
| IUPAC Name | [2,7-bis[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethylcarbamoyl]-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCNC(=O)c1ccc2c(c1)C(COC(=O)ON1C(=O)CCC1=O)c1cc(C(=O)NCCOCCOCCOCCN=[N+]=[N-])ccc1-2 |
| InChI | InChI=1S/C37H47N9O13/c38-44-42-9-13-54-17-21-56-19-15-52-11-7-40-35(49)26-1-3-28-29-4-2-27(36(50)41-8-12-53-16-20-57-22-18-55-14-10-43-45-39)24-31(29)32(30(28)23-26)25-58-37(51)59-46-33(47)5-6-34(46)48/h1-4,23-24,32H,5-22,25H2,(H,40,49)(H,41,50) |
| InChIKey | XFGBPTXUPMVOQU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 284.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.83 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|