C27H30N4O7 — CID 167651855
[2-[4-(2-azidoethoxy)butanoyl]-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate;ethane (PubChem CID 167651855) has the molecular formula C27H30N4O7 and a molecular weight of 522.56 g/mol. Its IUPAC name is [2-[4-(2-azidoethoxy)butanoyl]-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate;ethane.
| Compound Name | [2-[4-(2-azidoethoxy)butanoyl]-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate;ethane |
|---|---|
| PubChem CID | 167651855 |
| Molecular Formula | C27H30N4O7 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | [2-[4-(2-azidoethoxy)butanoyl]-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate;ethane |
| SMILES | CC.[N-]=[N+]=NCCOCCCC(=O)c1ccc2c(c1)C(COC(=O)ON1C(=O)CCC1=O)c1ccccc1-2 |
| InChI | InChI=1S/C25H24N4O7.C2H6/c26-28-27-11-13-34-12-3-6-22(30)16-7-8-19-17-4-1-2-5-18(17)21(20(19)14-16)15-35-25(33)36-29-23(31)9-10-24(29)32;1-2/h1-2,4-5,7-8,14,21H,3,6,9-13,15H2;1-2H3 |
| InChIKey | QRORXYUGHCPLSL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 147.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|