C27H22N2O8 — CID 118632709
[2-[3-(2,5-dioxocyclopent-3-en-1-yl)propanoylamino]-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 118632709) has the molecular formula C27H22N2O8 and a molecular weight of 502.48 g/mol. Its IUPAC name is [2-[3-(2,5-dioxocyclopent-3-en-1-yl)propanoylamino]-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | [2-[3-(2,5-dioxocyclopent-3-en-1-yl)propanoylamino]-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 118632709 |
| Molecular Formula | C27H22N2O8 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | [2-[3-(2,5-dioxocyclopent-3-en-1-yl)propanoylamino]-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | O=C(CCC1C(=O)C=CC1=O)Nc1ccc2c(c1)C(COC(=O)ON1C(=O)CCC1=O)c1ccccc1-2 |
| InChI | InChI=1S/C27H22N2O8/c30-22-8-9-23(31)19(22)7-10-24(32)28-15-5-6-18-16-3-1-2-4-17(16)21(20(18)13-15)14-36-27(35)37-29-25(33)11-12-26(29)34/h1-6,8-9,13,19,21H,7,10-12,14H2,(H,28,32) |
| InChIKey | OSZBSVWSEQPFCM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|