C19H15NO6 — CID 18968177
(2,5-dioxopyrrolidin-1-yl) 9H-fluoren-9-ylmethoxy carbonate (PubChem CID 18968177) has the molecular formula C19H15NO6 and a molecular weight of 353.33 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 9H-fluoren-9-ylmethoxy carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 9H-fluoren-9-ylmethoxy carbonate |
|---|---|
| PubChem CID | 18968177 |
| Molecular Formula | C19H15NO6 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 9H-fluoren-9-ylmethoxy carbonate |
| SMILES | O=C(OOCC1c2ccccc2-c2ccccc21)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H15NO6/c21-17-9-10-18(22)20(17)25-19(23)26-24-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16H,9-11H2 |
| InChIKey | CWYWQBJUULAPSI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|