About 9H-fluoren-9-ylmethoxy carbonochloridate
9H-fluoren-9-ylmethoxy carbonochloridate (PubChem CID 22145274) has the molecular formula C15H11ClO3
and a molecular weight of 274.70 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethoxy carbonochloridate.
Molecular Properties
| Compound Name | 9H-fluoren-9-ylmethoxy carbonochloridate |
| PubChem CID | 22145274 |
| Molecular Formula | C15H11ClO3 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 9H-fluoren-9-ylmethoxy carbonochloridate |
| SMILES | O=C(Cl)OOCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C15H11ClO3/c16-15(17)19-18-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2 |
| InChIKey | FTQGEBZZWAMLJF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-9-ylmethoxy carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-ylmethoxy carbonochloridate?
The IUPAC name of 9H-fluoren-9-ylmethoxy carbonochloridate (CID 22145274) is 9H-fluoren-9-ylmethoxy carbonochloridate.
What is the SMILES notation for 9H-fluoren-9-ylmethoxy carbonochloridate?
The canonical SMILES for 9H-fluoren-9-ylmethoxy carbonochloridate is O=C(Cl)OOCC1c2ccccc2-c2ccccc21.
What is the InChIKey of 9H-fluoren-9-ylmethoxy carbonochloridate?
The InChIKey is FTQGEBZZWAMLJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClO3/c16-15(17)19-18-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14H,9H2.
What are the key properties of 9H-fluoren-9-ylmethoxy carbonochloridate?
9H-fluoren-9-ylmethoxy carbonochloridate has a molecular weight of 274.70 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-ylmethoxy carbonochloridate is sourced from PubChem (CID 22145274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).