C24H23N3O7 — CID 118088024
[2,7-bis(propanoylamino)-9H-fluoren-9-yl] (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 118088024) has the molecular formula C24H23N3O7 and a molecular weight of 465.46 g/mol. Its IUPAC name is [2,7-bis(propanoylamino)-9H-fluoren-9-yl] (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | [2,7-bis(propanoylamino)-9H-fluoren-9-yl] (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 118088024 |
| Molecular Formula | C24H23N3O7 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | [2,7-bis(propanoylamino)-9H-fluoren-9-yl] (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | CCC(=O)Nc1ccc2c(c1)C(OC(=O)ON1C(=O)CCC1=O)c1cc(NC(=O)CC)ccc1-2 |
| InChI | InChI=1S/C24H23N3O7/c1-3-19(28)25-13-5-7-15-16-8-6-14(26-20(29)4-2)12-18(16)23(17(15)11-13)33-24(32)34-27-21(30)9-10-22(27)31/h5-8,11-12,23H,3-4,9-10H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | VUOUZRLGCGDBIO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|