C14H12N2O5 — CID 154982114
(2,5-dioxopyrrol-1-yl) 4-(propanoylamino)benzoate (PubChem CID 154982114) has the molecular formula C14H12N2O5 and a molecular weight of 288.26 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl) 4-(propanoylamino)benzoate.
| Compound Name | (2,5-dioxopyrrol-1-yl) 4-(propanoylamino)benzoate |
|---|---|
| PubChem CID | 154982114 |
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl) 4-(propanoylamino)benzoate |
| SMILES | CCC(=O)Nc1ccc(C(=O)ON2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C14H12N2O5/c1-2-11(17)15-10-5-3-9(4-6-10)14(20)21-16-12(18)7-8-13(16)19/h3-8H,2H2,1H3,(H,15,17) |
| InChIKey | JMGWZWCNRJKSQB-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|