C36H38N4O4 — CID 161186199
[2,7-bis(propanoylamino)-9H-fluoren-9-yl]methyl propanoate;9H-fluorene-2,7-diamine (PubChem CID 161186199) has the molecular formula C36H38N4O4 and a molecular weight of 590.72 g/mol. Its IUPAC name is [2,7-bis(propanoylamino)-9H-fluoren-9-yl]methyl propanoate;9H-fluorene-2,7-diamine.
| Compound Name | [2,7-bis(propanoylamino)-9H-fluoren-9-yl]methyl propanoate;9H-fluorene-2,7-diamine |
|---|---|
| PubChem CID | 161186199 |
| Molecular Formula | C36H38N4O4 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | [2,7-bis(propanoylamino)-9H-fluoren-9-yl]methyl propanoate;9H-fluorene-2,7-diamine |
| SMILES | CCC(=O)Nc1ccc2c(c1)C(COC(=O)CC)c1cc(NC(=O)CC)ccc1-2.Nc1ccc2c(c1)Cc1cc(N)ccc1-2 |
| InChI | InChI=1S/C23H26N2O4.C13H12N2/c1-4-21(26)24-14-7-9-16-17-10-8-15(25-22(27)5-2)12-19(17)20(18(16)11-14)13-29-23(28)6-3;14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h7-12,20H,4-6,13H2,1-3H3,(H,24,26)(H,25,27);1-4,6-7H,5,14-15H2 |
| InChIKey | UTCNHTHRRAQZHI-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|