C27H36N3O6P — CID 158486912
[2,7-bis[(2-propoxyacetyl)amino]-9H-fluoren-9-yl]methyl propanoate;deuterioiminophosphane (PubChem CID 158486912) has the molecular formula C27H36N3O6P and a molecular weight of 530.58 g/mol. Its IUPAC name is [2,7-bis[(2-propoxyacetyl)amino]-9H-fluoren-9-yl]methyl propanoate;deuterioiminophosphane.
| Compound Name | [2,7-bis[(2-propoxyacetyl)amino]-9H-fluoren-9-yl]methyl propanoate;deuterioiminophosphane |
|---|---|
| PubChem CID | 158486912 |
| Molecular Formula | C27H36N3O6P |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | [2,7-bis[(2-propoxyacetyl)amino]-9H-fluoren-9-yl]methyl propanoate;deuterioiminophosphane |
| SMILES | CCCOCC(=O)Nc1ccc2c(c1)C(COC(=O)CC)c1cc(NC(=O)COCCC)ccc1-2.[H]/P=N/[2H] |
| InChI | InChI=1S/C27H34N2O6.H2NP/c1-4-11-33-16-25(30)28-18-7-9-20-21-10-8-19(29-26(31)17-34-12-5-2)14-23(21)24(22(20)13-18)15-35-27(32)6-3;1-2/h7-10,13-14,24H,4-6,11-12,15-17H2,1-3H3,(H,28,30)(H,29,31);1-2H/i/hD |
| InChIKey | HIFCAGWXPSGGOA-DYCDLGHISA-N |
| XLogP | 5.37 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|