C39H46N4O4 — CID 159430179
[2-(butanoylamino)-7-(propanoylamino)-9H-fluoren-9-yl]methyl propanoate;ethane;9H-fluorene-2,7-diamine (PubChem CID 159430179) has the molecular formula C39H46N4O4 and a molecular weight of 634.82 g/mol. Its IUPAC name is [2-(butanoylamino)-7-(propanoylamino)-9H-fluoren-9-yl]methyl propanoate;ethane;9H-fluorene-2,7-diamine.
| Compound Name | [2-(butanoylamino)-7-(propanoylamino)-9H-fluoren-9-yl]methyl propanoate;ethane;9H-fluorene-2,7-diamine |
|---|---|
| PubChem CID | 159430179 |
| Molecular Formula | C39H46N4O4 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.35 |
| IUPAC Name | [2-(butanoylamino)-7-(propanoylamino)-9H-fluoren-9-yl]methyl propanoate;ethane;9H-fluorene-2,7-diamine |
| SMILES | CC.CCCC(=O)Nc1ccc2c(c1)C(COC(=O)CC)c1cc(NC(=O)CC)ccc1-2.Nc1ccc2c(c1)Cc1cc(N)ccc1-2 |
| InChI | InChI=1S/C24H28N2O4.C13H12N2.C2H6/c1-4-7-23(28)26-16-9-11-18-17-10-8-15(25-22(27)5-2)12-19(17)21(20(18)13-16)14-30-24(29)6-3;14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12;1-2/h8-13,21H,4-7,14H2,1-3H3,(H,25,27)(H,26,28);1-4,6-7H,5,14-15H2;1-2H3 |
| InChIKey | LQWQBFOWDAYRNY-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|