C16H20N4O — CID 54795017
N-[4-(2,4-diaminoanilino)phenyl]butanamide (PubChem CID 54795017) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is N-[4-(2,4-diaminoanilino)phenyl]butanamide.
| Compound Name | N-[4-(2,4-diaminoanilino)phenyl]butanamide |
|---|---|
| PubChem CID | 54795017 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | N-[4-(2,4-diaminoanilino)phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(Nc2ccc(N)cc2N)cc1 |
| InChI | InChI=1S/C16H20N4O/c1-2-3-16(21)20-13-7-5-12(6-8-13)19-15-9-4-11(17)10-14(15)18/h4-10,19H,2-3,17-18H2,1H3,(H,20,21) |
| InChIKey | KIZRVGIYPMPYFC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|