C18H24N2O — CID 68720946
2-ethylaniline;N-phenylbutanamide (PubChem CID 68720946) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-ethylaniline;N-phenylbutanamide.
| Compound Name | 2-ethylaniline;N-phenylbutanamide |
|---|---|
| PubChem CID | 68720946 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-ethylaniline;N-phenylbutanamide |
| SMILES | CCCC(=O)Nc1ccccc1.CCc1ccccc1N |
| InChI | InChI=1S/C10H13NO.C8H11N/c1-2-6-10(12)11-9-7-4-3-5-8-9;1-2-7-5-3-4-6-8(7)9/h3-5,7-8H,2,6H2,1H3,(H,11,12);3-6H,2,9H2,1H3 |
| InChIKey | YGICWKLCQBSFQD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|