C31H42N4O7 — CID 122691690
[2-[[5-oxo-5-(2-propoxyethylamino)pentanoyl]amino]-7-(2-propoxyethylcarbamoyl)-9H-fluoren-9-yl]methyl carbamate (PubChem CID 122691690) has the molecular formula C31H42N4O7 and a molecular weight of 582.70 g/mol. Its IUPAC name is [2-[[5-oxo-5-(2-propoxyethylamino)pentanoyl]amino]-7-(2-propoxyethylcarbamoyl)-9H-fluoren-9-yl]methyl carbamate.
| Compound Name | [2-[[5-oxo-5-(2-propoxyethylamino)pentanoyl]amino]-7-(2-propoxyethylcarbamoyl)-9H-fluoren-9-yl]methyl carbamate |
|---|---|
| PubChem CID | 122691690 |
| Molecular Formula | C31H42N4O7 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | [2-[[5-oxo-5-(2-propoxyethylamino)pentanoyl]amino]-7-(2-propoxyethylcarbamoyl)-9H-fluoren-9-yl]methyl carbamate |
| SMILES | CCCOCCNC(=O)CCCC(=O)Nc1ccc2c(c1)C(COC(N)=O)c1cc(C(=O)NCCOCCC)ccc1-2 |
| InChI | InChI=1S/C31H42N4O7/c1-3-14-40-16-12-33-28(36)6-5-7-29(37)35-22-9-11-24-23-10-8-21(30(38)34-13-17-41-15-4-2)18-25(23)27(26(24)19-22)20-42-31(32)39/h8-11,18-19,27H,3-7,12-17,20H2,1-2H3,(H2,32,39)(H,33,36)(H,34,38)(H,35,37) |
| InChIKey | IISUTRMHZUXQSB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|