C30H41N3O6 — CID 122691692
[2-[4-oxo-4-(2-propoxyethylamino)butyl]-5-(2-propoxyethylcarbamoyl)-9H-fluoren-9-yl]methyl carbamate (PubChem CID 122691692) has the molecular formula C30H41N3O6 and a molecular weight of 539.67 g/mol. Its IUPAC name is [2-[4-oxo-4-(2-propoxyethylamino)butyl]-5-(2-propoxyethylcarbamoyl)-9H-fluoren-9-yl]methyl carbamate.
| Compound Name | [2-[4-oxo-4-(2-propoxyethylamino)butyl]-5-(2-propoxyethylcarbamoyl)-9H-fluoren-9-yl]methyl carbamate |
|---|---|
| PubChem CID | 122691692 |
| Molecular Formula | C30H41N3O6 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | [2-[4-oxo-4-(2-propoxyethylamino)butyl]-5-(2-propoxyethylcarbamoyl)-9H-fluoren-9-yl]methyl carbamate |
| SMILES | CCCOCCNC(=O)CCCc1ccc2c(c1)C(COC(N)=O)c1cccc(C(=O)NCCOCCC)c1-2 |
| InChI | InChI=1S/C30H41N3O6/c1-3-15-37-17-13-32-27(34)10-5-7-21-11-12-23-25(19-21)26(20-39-30(31)36)22-8-6-9-24(28(22)23)29(35)33-14-18-38-16-4-2/h6,8-9,11-12,19,26H,3-5,7,10,13-18,20H2,1-2H3,(H2,31,36)(H,32,34)(H,33,35) |
| InChIKey | PNXIWVGAGHPLPT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|