C33H40N4O8 — CID 90723199
[2-[[5-(butylamino)-5-oxopentanoyl]amino]-5-(butylcarbamoyl)-9H-fluoren-9-yl]methyl (2,5-dihydroxypyrrol-1-yl) carbonate (PubChem CID 90723199) has the molecular formula C33H40N4O8 and a molecular weight of 620.70 g/mol. Its IUPAC name is [2-[[5-(butylamino)-5-oxopentanoyl]amino]-5-(butylcarbamoyl)-9H-fluoren-9-yl]methyl (2,5-dihydroxypyrrol-1-yl) carbonate.
| Compound Name | [2-[[5-(butylamino)-5-oxopentanoyl]amino]-5-(butylcarbamoyl)-9H-fluoren-9-yl]methyl (2,5-dihydroxypyrrol-1-yl) carbonate |
|---|---|
| PubChem CID | 90723199 |
| Molecular Formula | C33H40N4O8 |
| Molecular Weight | 620.70 g/mol |
| Exact Mass | 620.28 |
| IUPAC Name | [2-[[5-(butylamino)-5-oxopentanoyl]amino]-5-(butylcarbamoyl)-9H-fluoren-9-yl]methyl (2,5-dihydroxypyrrol-1-yl) carbonate |
| SMILES | CCCCNC(=O)CCCC(=O)Nc1ccc2c(c1)C(COC(=O)On1c(O)ccc1O)c1cccc(C(=O)NCCCC)c1-2 |
| InChI | InChI=1S/C33H40N4O8/c1-3-5-17-34-27(38)11-8-12-28(39)36-21-13-14-23-25(19-21)26(20-44-33(43)45-37-29(40)15-16-30(37)41)22-9-7-10-24(31(22)23)32(42)35-18-6-4-2/h7,9-10,13-16,19,26,40-41H,3-6,8,11-12,17-18,20H2,1-2H3,(H,34,38)(H,35,42)(H,36,39) |
| InChIKey | FZVUSSZYPRTPRB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 168.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.70 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|