C36H47N3O11 — CID 58856633
(2,5-dioxopyrrolidin-1-yl) [5-[2-(4-hydroxybutoxy)ethylcarbamoyl]-2-[4-[2-(3-methoxypropoxy)ethylamino]-4-oxobutyl]-9H-fluoren-9-yl]methyl carbonate (PubChem CID 58856633) has the molecular formula C36H47N3O11 and a molecular weight of 697.78 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) [5-[2-(4-hydroxybutoxy)ethylcarbamoyl]-2-[4-[2-(3-methoxypropoxy)ethylamino]-4-oxobutyl]-9H-fluoren-9-yl]methyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) [5-[2-(4-hydroxybutoxy)ethylcarbamoyl]-2-[4-[2-(3-methoxypropoxy)ethylamino]-4-oxobutyl]-9H-fluoren-9-yl]methyl carbonate |
|---|---|
| PubChem CID | 58856633 |
| Molecular Formula | C36H47N3O11 |
| Molecular Weight | 697.78 g/mol |
| Exact Mass | 697.32 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) [5-[2-(4-hydroxybutoxy)ethylcarbamoyl]-2-[4-[2-(3-methoxypropoxy)ethylamino]-4-oxobutyl]-9H-fluoren-9-yl]methyl carbonate |
| SMILES | COCCCOCCNC(=O)CCCc1ccc2c(c1)C(COC(=O)ON1C(=O)CCC1=O)c1cccc(C(=O)NCCOCCCCO)c1-2 |
| InChI | InChI=1S/C36H47N3O11/c1-46-18-6-20-48-21-15-37-31(41)10-4-7-25-11-12-27-29(23-25)30(24-49-36(45)50-39-32(42)13-14-33(39)43)26-8-5-9-28(34(26)27)35(44)38-16-22-47-19-3-2-17-40/h5,8-9,11-12,23,30,40H,2-4,6-7,10,13-22,24H2,1H3,(H,37,41)(H,38,44) |
| InChIKey | VLWQTWFNHDMKFQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 179.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.78 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|