C37H48N2O11 — CID 157273937
(2,5-dioxopyrrolidin-1-yl) [5-[4-(4-hydroxybutan-2-yloxy)butanoyl]-2-[4-[2-(3-methoxypropoxy)ethylamino]-4-oxobutyl]-9H-fluoren-9-yl]methyl carbonate (PubChem CID 157273937) has the molecular formula C37H48N2O11 and a molecular weight of 696.79 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) [5-[4-(4-hydroxybutan-2-yloxy)butanoyl]-2-[4-[2-(3-methoxypropoxy)ethylamino]-4-oxobutyl]-9H-fluoren-9-yl]methyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) [5-[4-(4-hydroxybutan-2-yloxy)butanoyl]-2-[4-[2-(3-methoxypropoxy)ethylamino]-4-oxobutyl]-9H-fluoren-9-yl]methyl carbonate |
|---|---|
| PubChem CID | 157273937 |
| Molecular Formula | C37H48N2O11 |
| Molecular Weight | 696.79 g/mol |
| Exact Mass | 696.33 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) [5-[4-(4-hydroxybutan-2-yloxy)butanoyl]-2-[4-[2-(3-methoxypropoxy)ethylamino]-4-oxobutyl]-9H-fluoren-9-yl]methyl carbonate |
| SMILES | COCCCOCCNC(=O)CCCc1ccc2c(c1)C(COC(=O)ON1C(=O)CCC1=O)c1cccc(C(=O)CCCOC(C)CCO)c1-2 |
| InChI | InChI=1S/C37H48N2O11/c1-25(16-18-40)48-21-5-10-32(41)29-9-4-8-27-31(24-49-37(45)50-39-34(43)14-15-35(39)44)30-23-26(12-13-28(30)36(27)29)7-3-11-33(42)38-17-22-47-20-6-19-46-2/h4,8-9,12-13,23,25,31,40H,3,5-7,10-11,14-22,24H2,1-2H3,(H,38,42) |
| InChIKey | FKPZXADKPKVWJC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 167.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.79 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|