C28H31NO8 — CID 159378699
(2,5-dioxopyrrolidin-1-yl) [5-[4-(4-hydroxybutoxy)butanoyl]-2-methyl-9H-fluoren-9-yl]methyl carbonate (PubChem CID 159378699) has the molecular formula C28H31NO8 and a molecular weight of 509.56 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) [5-[4-(4-hydroxybutoxy)butanoyl]-2-methyl-9H-fluoren-9-yl]methyl carbonate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) [5-[4-(4-hydroxybutoxy)butanoyl]-2-methyl-9H-fluoren-9-yl]methyl carbonate |
|---|---|
| PubChem CID | 159378699 |
| Molecular Formula | C28H31NO8 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) [5-[4-(4-hydroxybutoxy)butanoyl]-2-methyl-9H-fluoren-9-yl]methyl carbonate |
| SMILES | Cc1ccc2c(c1)C(COC(=O)ON1C(=O)CCC1=O)c1cccc(C(=O)CCCOCCCCO)c1-2 |
| InChI | InChI=1S/C28H31NO8/c1-18-9-10-20-22(16-18)23(17-36-28(34)37-29-25(32)11-12-26(29)33)19-6-4-7-21(27(19)20)24(31)8-5-15-35-14-3-2-13-30/h4,6-7,9-10,16,23,30H,2-3,5,8,11-15,17H2,1H3 |
| InChIKey | JNGWZGUHBDZANW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|