C27H29N3O7 — CID 163680994
[2,7-bis(propylcarbamoyl)-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate (PubChem CID 163680994) has the molecular formula C27H29N3O7 and a molecular weight of 507.54 g/mol. Its IUPAC name is [2,7-bis(propylcarbamoyl)-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate.
| Compound Name | [2,7-bis(propylcarbamoyl)-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
|---|---|
| PubChem CID | 163680994 |
| Molecular Formula | C27H29N3O7 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | [2,7-bis(propylcarbamoyl)-9H-fluoren-9-yl]methyl (2,5-dioxopyrrolidin-1-yl) carbonate |
| SMILES | CCCNC(=O)c1ccc2c(c1)C(COC(=O)ON1C(=O)CCC1=O)c1cc(C(=O)NCCC)ccc1-2 |
| InChI | InChI=1S/C27H29N3O7/c1-3-11-28-25(33)16-5-7-18-19-8-6-17(26(34)29-12-4-2)14-21(19)22(20(18)13-16)15-36-27(35)37-30-23(31)9-10-24(30)32/h5-8,13-14,22H,3-4,9-12,15H2,1-2H3,(H,28,33)(H,29,34) |
| InChIKey | JKUWTDKLUNQBDL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|