C29H39N3O7 — CID 89247588
[2-[2-(1-ethoxyethoxy)ethylcarbamoyl]-7-(2-propan-2-yloxyethylcarbamoyl)-9H-fluoren-9-yl]methyl N-methylcarbamate (PubChem CID 89247588) has the molecular formula C29H39N3O7 and a molecular weight of 541.65 g/mol. Its IUPAC name is [2-[2-(1-ethoxyethoxy)ethylcarbamoyl]-7-(2-propan-2-yloxyethylcarbamoyl)-9H-fluoren-9-yl]methyl N-methylcarbamate.
| Compound Name | [2-[2-(1-ethoxyethoxy)ethylcarbamoyl]-7-(2-propan-2-yloxyethylcarbamoyl)-9H-fluoren-9-yl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 89247588 |
| Molecular Formula | C29H39N3O7 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | [2-[2-(1-ethoxyethoxy)ethylcarbamoyl]-7-(2-propan-2-yloxyethylcarbamoyl)-9H-fluoren-9-yl]methyl N-methylcarbamate |
| SMILES | CCOC(C)OCCNC(=O)c1ccc2c(c1)C(COC(=O)NC)c1cc(C(=O)NCCOC(C)C)ccc1-2 |
| InChI | InChI=1S/C29H39N3O7/c1-6-36-19(4)38-14-12-32-28(34)21-8-10-23-22-9-7-20(27(33)31-11-13-37-18(2)3)15-24(22)26(25(23)16-21)17-39-29(35)30-5/h7-10,15-16,18-19,26H,6,11-14,17H2,1-5H3,(H,30,35)(H,31,33)(H,32,34) |
| InChIKey | VMRWNVDYTAQBGI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|