C34H38N2O8 — CID 167618736
[4-[[2,7-bis(4-methoxybutanoyl)-9H-fluoren-9-yl]methoxycarbonylamino]phenyl]methyl N-methylcarbamate (PubChem CID 167618736) has the molecular formula C34H38N2O8 and a molecular weight of 602.68 g/mol. Its IUPAC name is [4-[[2,7-bis(4-methoxybutanoyl)-9H-fluoren-9-yl]methoxycarbonylamino]phenyl]methyl N-methylcarbamate.
| Compound Name | [4-[[2,7-bis(4-methoxybutanoyl)-9H-fluoren-9-yl]methoxycarbonylamino]phenyl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 167618736 |
| Molecular Formula | C34H38N2O8 |
| Molecular Weight | 602.68 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | [4-[[2,7-bis(4-methoxybutanoyl)-9H-fluoren-9-yl]methoxycarbonylamino]phenyl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1ccc(NC(=O)OCC2c3cc(C(=O)CCCOC)ccc3-c3ccc(C(=O)CCCOC)cc32)cc1 |
| InChI | InChI=1S/C34H38N2O8/c1-35-33(39)43-20-22-8-12-25(13-9-22)36-34(40)44-21-30-28-18-23(31(37)6-4-16-41-2)10-14-26(28)27-15-11-24(19-29(27)30)32(38)7-5-17-42-3/h8-15,18-19,30H,4-7,16-17,20-21H2,1-3H3,(H,35,39)(H,36,40) |
| InChIKey | MCZVSWOZUAMCNN-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.68 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|