C35H49NO8 — CID 158788548
3-[2-[4-(4-hydroxybutoxy)butanoyl]-7-[4-(3-methoxypropoxy)butanoyl]-9H-fluoren-9-yl]propyl N-ethylcarbamate (PubChem CID 158788548) has the molecular formula C35H49NO8 and a molecular weight of 611.78 g/mol. Its IUPAC name is 3-[2-[4-(4-hydroxybutoxy)butanoyl]-7-[4-(3-methoxypropoxy)butanoyl]-9H-fluoren-9-yl]propyl N-ethylcarbamate.
| Compound Name | 3-[2-[4-(4-hydroxybutoxy)butanoyl]-7-[4-(3-methoxypropoxy)butanoyl]-9H-fluoren-9-yl]propyl N-ethylcarbamate |
|---|---|
| PubChem CID | 158788548 |
| Molecular Formula | C35H49NO8 |
| Molecular Weight | 611.78 g/mol |
| Exact Mass | 611.35 |
| IUPAC Name | 3-[2-[4-(4-hydroxybutoxy)butanoyl]-7-[4-(3-methoxypropoxy)butanoyl]-9H-fluoren-9-yl]propyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCCCC1c2cc(C(=O)CCCOCCCCO)ccc2-c2ccc(C(=O)CCCOCCCOC)cc21 |
| InChI | InChI=1S/C35H49NO8/c1-3-36-35(40)44-23-6-10-28-31-24-26(33(38)11-7-20-42-19-5-4-17-37)13-15-29(31)30-16-14-27(25-32(28)30)34(39)12-8-21-43-22-9-18-41-2/h13-16,24-25,28,37H,3-12,17-23H2,1-2H3,(H,36,40) |
| InChIKey | IRZGLHBBTDDPOE-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.78 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|