C35H48N2O8 — CID 159228809
[2-[[5-(2-butoxyethylamino)-5-oxopentanoyl]amino]-7-[4-(4-hydroxybutoxy)butanoyl]-9H-fluoren-9-yl]methyl acetate (PubChem CID 159228809) has the molecular formula C35H48N2O8 and a molecular weight of 624.78 g/mol. Its IUPAC name is [2-[[5-(2-butoxyethylamino)-5-oxopentanoyl]amino]-7-[4-(4-hydroxybutoxy)butanoyl]-9H-fluoren-9-yl]methyl acetate.
| Compound Name | [2-[[5-(2-butoxyethylamino)-5-oxopentanoyl]amino]-7-[4-(4-hydroxybutoxy)butanoyl]-9H-fluoren-9-yl]methyl acetate |
|---|---|
| PubChem CID | 159228809 |
| Molecular Formula | C35H48N2O8 |
| Molecular Weight | 624.78 g/mol |
| Exact Mass | 624.34 |
| IUPAC Name | [2-[[5-(2-butoxyethylamino)-5-oxopentanoyl]amino]-7-[4-(4-hydroxybutoxy)butanoyl]-9H-fluoren-9-yl]methyl acetate |
| SMILES | CCCCOCCNC(=O)CCCC(=O)Nc1ccc2c(c1)C(COC(C)=O)c1cc(C(=O)CCCOCCCCO)ccc1-2 |
| InChI | InChI=1S/C35H48N2O8/c1-3-4-18-44-21-16-36-34(41)10-7-11-35(42)37-27-13-15-29-28-14-12-26(33(40)9-8-20-43-19-6-5-17-38)22-30(28)32(31(29)23-27)24-45-25(2)39/h12-15,22-23,32,38H,3-11,16-21,24H2,1-2H3,(H,36,41)(H,37,42) |
| InChIKey | YBZTVNLZWMNCOL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.78 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|