C32H42O8 — CID 158924255
[2-[4-(4-hydroxybutoxy)butanoyl]-7-[4-(3-methoxypropoxy)butanoyl]-9H-fluoren-9-yl]methyl acetate (PubChem CID 158924255) has the molecular formula C32H42O8 and a molecular weight of 554.68 g/mol. Its IUPAC name is [2-[4-(4-hydroxybutoxy)butanoyl]-7-[4-(3-methoxypropoxy)butanoyl]-9H-fluoren-9-yl]methyl acetate.
| Compound Name | [2-[4-(4-hydroxybutoxy)butanoyl]-7-[4-(3-methoxypropoxy)butanoyl]-9H-fluoren-9-yl]methyl acetate |
|---|---|
| PubChem CID | 158924255 |
| Molecular Formula | C32H42O8 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | [2-[4-(4-hydroxybutoxy)butanoyl]-7-[4-(3-methoxypropoxy)butanoyl]-9H-fluoren-9-yl]methyl acetate |
| SMILES | COCCCOCCCC(=O)c1ccc2c(c1)C(COC(C)=O)c1cc(C(=O)CCCOCCCCO)ccc1-2 |
| InChI | InChI=1S/C32H42O8/c1-23(34)40-22-30-28-20-24(31(35)8-5-17-38-16-4-3-14-33)10-12-26(28)27-13-11-25(21-29(27)30)32(36)9-6-18-39-19-7-15-37-2/h10-13,20-21,30,33H,3-9,14-19,22H2,1-2H3 |
| InChIKey | JIFOHIDETBHRLN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|