C33H43NO8 — CID 158588769
[2-[4-(3-methoxypropoxy)butanoyl]-7-[4-(4-oxobutoxy)butanoyl]-9H-fluoren-9-yl]methyl N-ethylcarbamate (PubChem CID 158588769) has the molecular formula C33H43NO8 and a molecular weight of 581.71 g/mol. Its IUPAC name is [2-[4-(3-methoxypropoxy)butanoyl]-7-[4-(4-oxobutoxy)butanoyl]-9H-fluoren-9-yl]methyl N-ethylcarbamate.
| Compound Name | [2-[4-(3-methoxypropoxy)butanoyl]-7-[4-(4-oxobutoxy)butanoyl]-9H-fluoren-9-yl]methyl N-ethylcarbamate |
|---|---|
| PubChem CID | 158588769 |
| Molecular Formula | C33H43NO8 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | [2-[4-(3-methoxypropoxy)butanoyl]-7-[4-(4-oxobutoxy)butanoyl]-9H-fluoren-9-yl]methyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCC1c2cc(C(=O)CCCOCCCC=O)ccc2-c2ccc(C(=O)CCCOCCCOC)cc21 |
| InChI | InChI=1S/C33H43NO8/c1-3-34-33(38)42-23-30-28-21-24(31(36)9-6-18-40-17-5-4-15-35)11-13-26(28)27-14-12-25(22-29(27)30)32(37)10-7-19-41-20-8-16-39-2/h11-15,21-22,30H,3-10,16-20,23H2,1-2H3,(H,34,38) |
| InChIKey | HUEBBBGVFULKFG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|