C16H31NO8 — CID 58331196
2-methoxyethyl N-[2-[2-[2-[2-(4-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 58331196) has the molecular formula C16H31NO8 and a molecular weight of 365.42 g/mol. Its IUPAC name is 2-methoxyethyl N-[2-[2-[2-[2-(4-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | 2-methoxyethyl N-[2-[2-[2-[2-(4-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 58331196 |
| Molecular Formula | C16H31NO8 |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-methoxyethyl N-[2-[2-[2-[2-(4-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | COCCOC(=O)NCCOCCOCCOCCOCCCC=O |
| InChI | InChI=1S/C16H31NO8/c1-20-8-15-25-16(19)17-4-7-22-10-12-24-14-13-23-11-9-21-6-3-2-5-18/h5H,2-4,6-15H2,1H3,(H,17,19) |
| InChIKey | LVVHLRGIYZFSEL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|