About ethyl N-(5-oxopentyl)carbamate
ethyl N-(5-oxopentyl)carbamate (PubChem CID 58601506) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is ethyl N-(5-oxopentyl)carbamate.
Molecular Properties
| Compound Name | ethyl N-(5-oxopentyl)carbamate |
| PubChem CID | 58601506 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | ethyl N-(5-oxopentyl)carbamate |
| SMILES | CCOC(=O)NCCCCC=O |
| InChI | InChI=1S/C8H15NO3/c1-2-12-8(11)9-6-4-3-5-7-10/h7H,2-6H2,1H3,(H,9,11) |
| InChIKey | VWMVYCFWZZPTQN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-(5-oxopentyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(5-oxopentyl)carbamate?
The IUPAC name of ethyl N-(5-oxopentyl)carbamate (CID 58601506) is ethyl N-(5-oxopentyl)carbamate.
What is the SMILES notation for ethyl N-(5-oxopentyl)carbamate?
The canonical SMILES for ethyl N-(5-oxopentyl)carbamate is CCOC(=O)NCCCCC=O.
What is the InChIKey of ethyl N-(5-oxopentyl)carbamate?
The InChIKey is VWMVYCFWZZPTQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-2-12-8(11)9-6-4-3-5-7-10/h7H,2-6H2,1H3,(H,9,11).
What are the key properties of ethyl N-(5-oxopentyl)carbamate?
ethyl N-(5-oxopentyl)carbamate has a molecular weight of 173.21 g/mol, XLogP of 1.10, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(5-oxopentyl)carbamate is sourced from PubChem (CID 58601506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).