About heptanal;hexylcarbamic acid
heptanal;hexylcarbamic acid (PubChem CID 158316661) has the molecular formula C14H29NO3
and a molecular weight of 259.39 g/mol. Its IUPAC name is heptanal;hexylcarbamic acid.
Molecular Properties
| Compound Name | heptanal;hexylcarbamic acid |
| PubChem CID | 158316661 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | heptanal;hexylcarbamic acid |
| SMILES | CCCCCCC=O.CCCCCCNC(=O)O |
| InChI | InChI=1S/C7H15NO2.C7H14O/c1-2-3-4-5-6-8-7(9)10;1-2-3-4-5-6-7-8/h8H,2-6H2,1H3,(H,9,10);7H,2-6H2,1H3 |
| InChIKey | GOILUCGVZDHGKU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze heptanal;hexylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptanal;hexylcarbamic acid?
The IUPAC name of heptanal;hexylcarbamic acid (CID 158316661) is heptanal;hexylcarbamic acid.
What is the SMILES notation for heptanal;hexylcarbamic acid?
The canonical SMILES for heptanal;hexylcarbamic acid is CCCCCCC=O.CCCCCCNC(=O)O.
What is the InChIKey of heptanal;hexylcarbamic acid?
The InChIKey is GOILUCGVZDHGKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.C7H14O/c1-2-3-4-5-6-8-7(9)10;1-2-3-4-5-6-7-8/h8H,2-6H2,1H3,(H,9,10);7H,2-6H2,1H3.
What are the key properties of heptanal;hexylcarbamic acid?
heptanal;hexylcarbamic acid has a molecular weight of 259.39 g/mol, XLogP of 3.99, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptanal;hexylcarbamic acid is sourced from PubChem (CID 158316661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).