About aziridine;octadecylcarbamic acid
aziridine;octadecylcarbamic acid (PubChem CID 88639919) has the molecular formula C21H44N2O2
and a molecular weight of 356.60 g/mol. Its IUPAC name is aziridine;octadecylcarbamic acid.
Molecular Properties
| Compound Name | aziridine;octadecylcarbamic acid |
| PubChem CID | 88639919 |
| Molecular Formula | C21H44N2O2 |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 356.34 |
| IUPAC Name | aziridine;octadecylcarbamic acid |
| SMILES | C1CN1.CCCCCCCCCCCCCCCCCCNC(=O)O |
| InChI | InChI=1S/C19H39NO2.C2H5N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-19(21)22;1-2-3-1/h20H,2-18H2,1H3,(H,21,22);3H,1-2H2 |
| InChIKey | XCYZABVJIKOSAF-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 71.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze aziridine;octadecylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aziridine;octadecylcarbamic acid?
The IUPAC name of aziridine;octadecylcarbamic acid (CID 88639919) is aziridine;octadecylcarbamic acid.
What is the SMILES notation for aziridine;octadecylcarbamic acid?
The canonical SMILES for aziridine;octadecylcarbamic acid is C1CN1.CCCCCCCCCCCCCCCCCCNC(=O)O.
What is the InChIKey of aziridine;octadecylcarbamic acid?
The InChIKey is XCYZABVJIKOSAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39NO2.C2H5N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-19(21)22;1-2-3-1/h20H,2-18H2,1H3,(H,21,22);3H,1-2H2.
What are the key properties of aziridine;octadecylcarbamic acid?
aziridine;octadecylcarbamic acid has a molecular weight of 356.60 g/mol, XLogP of 6.11, 17 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aziridine;octadecylcarbamic acid is sourced from PubChem (CID 88639919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).