C16H32N2O8 — CID 177055297
2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl N-[2-(2-methoxyethoxy)ethyl]carbamate (PubChem CID 177055297) has the molecular formula C16H32N2O8 and a molecular weight of 380.44 g/mol. Its IUPAC name is 2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl N-[2-(2-methoxyethoxy)ethyl]carbamate.
| Compound Name | 2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl N-[2-(2-methoxyethoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 177055297 |
| Molecular Formula | C16H32N2O8 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2-[2-[2-(2-acetamidoethoxy)ethoxy]ethoxy]ethyl N-[2-(2-methoxyethoxy)ethyl]carbamate |
| SMILES | COCCOCCNC(=O)OCCOCCOCCOCCNC(C)=O |
| InChI | InChI=1S/C16H32N2O8/c1-15(19)17-3-5-23-9-10-24-11-12-25-13-14-26-16(20)18-4-6-22-8-7-21-2/h3-14H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | JMDQFGOFMJNDPS-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|