C23H26N2O5 — CID 135228096
[2-formyl-7-(2-hydroxyethylcarbamoyl)-9H-fluoren-9-yl]methyl N-butylcarbamate (PubChem CID 135228096) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is [2-formyl-7-(2-hydroxyethylcarbamoyl)-9H-fluoren-9-yl]methyl N-butylcarbamate.
| Compound Name | [2-formyl-7-(2-hydroxyethylcarbamoyl)-9H-fluoren-9-yl]methyl N-butylcarbamate |
|---|---|
| PubChem CID | 135228096 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | [2-formyl-7-(2-hydroxyethylcarbamoyl)-9H-fluoren-9-yl]methyl N-butylcarbamate |
| SMILES | CCCCNC(=O)OCC1c2cc(C=O)ccc2-c2ccc(C(=O)NCCO)cc21 |
| InChI | InChI=1S/C23H26N2O5/c1-2-3-8-25-23(29)30-14-21-19-11-15(13-27)4-6-17(19)18-7-5-16(12-20(18)21)22(28)24-9-10-26/h4-7,11-13,21,26H,2-3,8-10,14H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | PAMQKNHAIGUUTR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|