C23H22N2O8 — CID 165397719
[2-formyl-7-(2-hydroxyethylcarbamoyl)-9H-fluoren-9-yl]methyl 5-(hydroxyamino)-2,5-dioxopentanoate (PubChem CID 165397719) has the molecular formula C23H22N2O8 and a molecular weight of 454.44 g/mol. Its IUPAC name is [2-formyl-7-(2-hydroxyethylcarbamoyl)-9H-fluoren-9-yl]methyl 5-(hydroxyamino)-2,5-dioxopentanoate.
| Compound Name | [2-formyl-7-(2-hydroxyethylcarbamoyl)-9H-fluoren-9-yl]methyl 5-(hydroxyamino)-2,5-dioxopentanoate |
|---|---|
| PubChem CID | 165397719 |
| Molecular Formula | C23H22N2O8 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | [2-formyl-7-(2-hydroxyethylcarbamoyl)-9H-fluoren-9-yl]methyl 5-(hydroxyamino)-2,5-dioxopentanoate |
| SMILES | O=Cc1ccc2c(c1)C(COC(=O)C(=O)CCC(=O)NO)c1cc(C(=O)NCCO)ccc1-2 |
| InChI | InChI=1S/C23H22N2O8/c26-8-7-24-22(30)14-2-4-16-15-3-1-13(11-27)9-17(15)19(18(16)10-14)12-33-23(31)20(28)5-6-21(29)25-32/h1-4,9-11,19,26,32H,5-8,12H2,(H,24,30)(H,25,29) |
| InChIKey | QATOHDKRNZFBBH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|