C18H28N2O5 — CID 89427030
N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]-4-formylbenzamide (PubChem CID 89427030) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]-4-formylbenzamide.
| Compound Name | N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]-4-formylbenzamide |
|---|---|
| PubChem CID | 89427030 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]-4-formylbenzamide |
| SMILES | NCCCOCCOCCOCCCNC(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C18H28N2O5/c19-7-1-9-23-11-13-25-14-12-24-10-2-8-20-18(22)17-5-3-16(15-21)4-6-17/h3-6,15H,1-2,7-14,19H2,(H,20,22) |
| InChIKey | LSJQRUDFWJULTC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|