C20H28N2O7 — CID 175868079
4-formyl-N-[2-[2-[2-[2-(4-oxobutanoylamino)ethoxy]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 175868079) has the molecular formula C20H28N2O7 and a molecular weight of 408.45 g/mol. Its IUPAC name is 4-formyl-N-[2-[2-[2-[2-(4-oxobutanoylamino)ethoxy]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | 4-formyl-N-[2-[2-[2-[2-(4-oxobutanoylamino)ethoxy]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 175868079 |
| Molecular Formula | C20H28N2O7 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4-formyl-N-[2-[2-[2-[2-(4-oxobutanoylamino)ethoxy]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | O=CCCC(=O)NCCOCCOCCOCCNC(=O)c1ccc(C=O)cc1 |
| InChI | InChI=1S/C20H28N2O7/c23-9-1-2-19(25)21-7-10-27-12-14-29-15-13-28-11-8-22-20(26)18-5-3-17(16-24)4-6-18/h3-6,9,16H,1-2,7-8,10-15H2,(H,21,25)(H,22,26) |
| InChIKey | AUQINBFPJVIBQR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|